ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate

C9H14N2O3 — CID 55264880

IUPACethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate
SMILESCCOC(=O)CN1N=C(C)CCC1=O
InChIInChI=1S/C9H14N2O3/c1-3-14-9(13)6-11-8(12)5-4-7(2)10-11/h3-6H2,1-2H3
InChIKeyOGAOTESPCKMISV-UHFFFAOYSA-N
MW198.22 g/mol
LogP0.55
Rot. Bonds3

About ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate

ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate (PubChem CID 55264880) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate.

Molecular Properties

Compound Nameethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate
PubChem CID55264880
Molecular FormulaC9H14N2O3
Molecular Weight198.22 g/mol
Exact Mass198.10
IUPAC Nameethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate
SMILESCCOC(=O)CN1N=C(C)CCC1=O
InChIInChI=1S/C9H14N2O3/c1-3-14-9(13)6-11-8(12)5-4-7(2)10-11/h3-6H2,1-2H3
InChIKeyOGAOTESPCKMISV-UHFFFAOYSA-N
XLogP0.55
TPSA58.97 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 50.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate?
The IUPAC name of ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate (CID 55264880) is ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate.
What is the SMILES notation for ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate?
The canonical SMILES for ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate is CCOC(=O)CN1N=C(C)CCC1=O.
What is the InChIKey of ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate?
The InChIKey is OGAOTESPCKMISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-3-14-9(13)6-11-8(12)5-4-7(2)10-11/h3-6H2,1-2H3.
What are the key properties of ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate?
ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate has a molecular weight of 198.22 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)acetate is sourced from PubChem (CID 55264880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).