C6H12F2N2 — CID 55265093
2-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]ethanamine (PubChem CID 55265093) has the molecular formula C6H12F2N2 and a molecular weight of 150.17 g/mol. Its IUPAC name is 2-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]ethanamine.
| Compound Name | 2-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 55265093 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]ethanamine |
| SMILES | NCCN1C[C@@H](F)[C@H](F)C1 |
| InChI | InChI=1S/C6H12F2N2/c7-5-3-10(2-1-9)4-6(5)8/h5-6H,1-4,9H2/t5-,6-/m1/s1 |
| InChIKey | WILLGJVEEBGWJD-PHDIDXHHSA-N |
| XLogP | -0.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |