About 3-(1,2,4-triazol-4-yl)propanimidamide
3-(1,2,4-triazol-4-yl)propanimidamide (PubChem CID 55265191) has the molecular formula C5H9N5
and a molecular weight of 139.16 g/mol. Its IUPAC name is 3-(1,2,4-triazol-4-yl)propanimidamide.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-4-yl)propanimidamide |
| PubChem CID | 55265191 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 3-(1,2,4-triazol-4-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CCn1cnnc1 |
| InChI | InChI=1S/C5H9N5/c6-5(7)1-2-10-3-8-9-4-10/h3-4H,1-2H2,(H3,6,7) |
| InChIKey | BDTYQRYAPWNGAV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,4-triazol-4-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-4-yl)propanimidamide?
The IUPAC name of 3-(1,2,4-triazol-4-yl)propanimidamide (CID 55265191) is 3-(1,2,4-triazol-4-yl)propanimidamide.
What is the SMILES notation for 3-(1,2,4-triazol-4-yl)propanimidamide?
The canonical SMILES for 3-(1,2,4-triazol-4-yl)propanimidamide is [H]/N=C(\N)CCn1cnnc1.
What is the InChIKey of 3-(1,2,4-triazol-4-yl)propanimidamide?
The InChIKey is BDTYQRYAPWNGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5/c6-5(7)1-2-10-3-8-9-4-10/h3-4H,1-2H2,(H3,6,7).
What are the key properties of 3-(1,2,4-triazol-4-yl)propanimidamide?
3-(1,2,4-triazol-4-yl)propanimidamide has a molecular weight of 139.16 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-4-yl)propanimidamide is sourced from PubChem (CID 55265191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).