About 5-fluoro-2,2-dimethyl-3H-inden-1-one
5-fluoro-2,2-dimethyl-3H-inden-1-one (PubChem CID 55265304) has the molecular formula C11H11FO
and a molecular weight of 178.21 g/mol. Its IUPAC name is 5-fluoro-2,2-dimethyl-3H-inden-1-one.
Molecular Properties
| Compound Name | 5-fluoro-2,2-dimethyl-3H-inden-1-one |
| PubChem CID | 55265304 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 5-fluoro-2,2-dimethyl-3H-inden-1-one |
| SMILES | CC1(C)Cc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C11H11FO/c1-11(2)6-7-5-8(12)3-4-9(7)10(11)13/h3-5H,6H2,1-2H3 |
| InChIKey | YLZKDXQYVAKNNL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2,2-dimethyl-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,2-dimethyl-3H-inden-1-one?
The IUPAC name of 5-fluoro-2,2-dimethyl-3H-inden-1-one (CID 55265304) is 5-fluoro-2,2-dimethyl-3H-inden-1-one.
What is the SMILES notation for 5-fluoro-2,2-dimethyl-3H-inden-1-one?
The canonical SMILES for 5-fluoro-2,2-dimethyl-3H-inden-1-one is CC1(C)Cc2cc(F)ccc2C1=O.
What is the InChIKey of 5-fluoro-2,2-dimethyl-3H-inden-1-one?
The InChIKey is YLZKDXQYVAKNNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO/c1-11(2)6-7-5-8(12)3-4-9(7)10(11)13/h3-5H,6H2,1-2H3.
What are the key properties of 5-fluoro-2,2-dimethyl-3H-inden-1-one?
5-fluoro-2,2-dimethyl-3H-inden-1-one has a molecular weight of 178.21 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,2-dimethyl-3H-inden-1-one is sourced from PubChem (CID 55265304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).