About 5-bromo-2-ethynylaniline
5-bromo-2-ethynylaniline (PubChem CID 55265354) has the molecular formula C8H6BrN
and a molecular weight of 196.05 g/mol. Its IUPAC name is 5-bromo-2-ethynylaniline.
Molecular Properties
| Compound Name | 5-bromo-2-ethynylaniline |
| PubChem CID | 55265354 |
| Molecular Formula | C8H6BrN |
| Molecular Weight | 196.05 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 5-bromo-2-ethynylaniline |
| SMILES | C#Cc1ccc(Br)cc1N |
| InChI | InChI=1S/C8H6BrN/c1-2-6-3-4-7(9)5-8(6)10/h1,3-5H,10H2 |
| InChIKey | PWVGVGXHWXWWMY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.05 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-ethynylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-ethynylaniline?
The IUPAC name of 5-bromo-2-ethynylaniline (CID 55265354) is 5-bromo-2-ethynylaniline.
What is the SMILES notation for 5-bromo-2-ethynylaniline?
The canonical SMILES for 5-bromo-2-ethynylaniline is C#Cc1ccc(Br)cc1N.
What is the InChIKey of 5-bromo-2-ethynylaniline?
The InChIKey is PWVGVGXHWXWWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN/c1-2-6-3-4-7(9)5-8(6)10/h1,3-5H,10H2.
What are the key properties of 5-bromo-2-ethynylaniline?
5-bromo-2-ethynylaniline has a molecular weight of 196.05 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-ethynylaniline is sourced from PubChem (CID 55265354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).