About (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one
(3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (PubChem CID 55265375) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
Molecular Properties
| Compound Name | (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| PubChem CID | 55265375 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| SMILES | O=C1OC[C@@H]2Cc3ccccc3N12 |
| InChI | InChI=1S/C10H9NO2/c12-10-11-8(6-13-10)5-7-3-1-2-4-9(7)11/h1-4,8H,5-6H2/t8-/m0/s1 |
| InChIKey | UYWJEDRSVUARIX-QMMMGPOBSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one?
The IUPAC name of (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (CID 55265375) is (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
What is the SMILES notation for (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one?
The canonical SMILES for (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one is O=C1OC[C@@H]2Cc3ccccc3N12.
What is the InChIKey of (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one?
The InChIKey is UYWJEDRSVUARIX-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H9NO2/c12-10-11-8(6-13-10)5-7-3-1-2-4-9(7)11/h1-4,8H,5-6H2/t8-/m0/s1.
What are the key properties of (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one?
(3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one has a molecular weight of 175.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one is sourced from PubChem (CID 55265375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).