About 2-(oxan-4-yl)acetamide
2-(oxan-4-yl)acetamide (PubChem CID 55265493) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(oxan-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)acetamide |
| PubChem CID | 55265493 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-(oxan-4-yl)acetamide |
| SMILES | NC(=O)CC1CCOCC1 |
| InChI | InChI=1S/C7H13NO2/c8-7(9)5-6-1-3-10-4-2-6/h6H,1-5H2,(H2,8,9) |
| InChIKey | IIPOZVLOXPIXKG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)acetamide?
The IUPAC name of 2-(oxan-4-yl)acetamide (CID 55265493) is 2-(oxan-4-yl)acetamide.
What is the SMILES notation for 2-(oxan-4-yl)acetamide?
The canonical SMILES for 2-(oxan-4-yl)acetamide is NC(=O)CC1CCOCC1.
What is the InChIKey of 2-(oxan-4-yl)acetamide?
The InChIKey is IIPOZVLOXPIXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c8-7(9)5-6-1-3-10-4-2-6/h6H,1-5H2,(H2,8,9).
What are the key properties of 2-(oxan-4-yl)acetamide?
2-(oxan-4-yl)acetamide has a molecular weight of 143.19 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)acetamide is sourced from PubChem (CID 55265493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).