C7H9N3 — CID 55265594
5,6,7,8-tetrahydropyrido[3,4-b]pyrazine (PubChem CID 55265594) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 5,6,7,8-tetrahydropyrido[3,4-b]pyrazine.
| Compound Name | 5,6,7,8-tetrahydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 55265594 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 5,6,7,8-tetrahydropyrido[3,4-b]pyrazine |
| SMILES | c1cnc2c(n1)CCNC2 |
| InChI | InChI=1S/C7H9N3/c1-2-8-5-7-6(1)9-3-4-10-7/h3-4,8H,1-2,5H2 |
| InChIKey | XPONSZGOXQPNGL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |