C11H17NO2 — CID 55265729
(3R)-3-amino-3-(4-methoxy-3-methylphenyl)propan-1-ol (PubChem CID 55265729) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (3R)-3-amino-3-(4-methoxy-3-methylphenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-3-(4-methoxy-3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 55265729 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (3R)-3-amino-3-(4-methoxy-3-methylphenyl)propan-1-ol |
| SMILES | COc1ccc([C@H](N)CCO)cc1C |
| InChI | InChI=1S/C11H17NO2/c1-8-7-9(10(12)5-6-13)3-4-11(8)14-2/h3-4,7,10,13H,5-6,12H2,1-2H3/t10-/m1/s1 |
| InChIKey | LIUQRLRMLOQFLQ-SNVBAGLBSA-N |
| XLogP | 1.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |