7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid

C8H5ClN2O2 — CID 55265824

IUPAC7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc(Cl)ccn12
InChIInChI=1S/C8H5ClN2O2/c9-5-1-2-11-6(8(12)13)4-10-7(11)3-5/h1-4H,(H,12,13)
InChIKeyUMXICVHNLVYJGI-UHFFFAOYSA-N
MW196.59 g/mol
LogP1.69
Rot. Bonds1

About 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid

7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 55265824) has the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. Its IUPAC name is 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid
PubChem CID55265824
Molecular FormulaC8H5ClN2O2
Molecular Weight196.59 g/mol
Exact Mass196.00
IUPAC Name7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc(Cl)ccn12
InChIInChI=1S/C8H5ClN2O2/c9-5-1-2-11-6(8(12)13)4-10-7(11)3-5/h1-4H,(H,12,13)
InChIKeyUMXICVHNLVYJGI-UHFFFAOYSA-N
XLogP1.69
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.59
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid?
The IUPAC name of 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid (CID 55265824) is 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid?
The canonical SMILES for 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid is O=C(O)c1cnc2cc(Cl)ccn12.
What is the InChIKey of 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid?
The InChIKey is UMXICVHNLVYJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O2/c9-5-1-2-11-6(8(12)13)4-10-7(11)3-5/h1-4H,(H,12,13).
What are the key properties of 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid?
7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid has a molecular weight of 196.59 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloroimidazo[1,2-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 55265824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).