About 2-fluoro-7,7-dimethoxyheptanal
2-fluoro-7,7-dimethoxyheptanal (PubChem CID 55266110) has the molecular formula C9H17FO3
and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-fluoro-7,7-dimethoxyheptanal.
Molecular Properties
| Compound Name | 2-fluoro-7,7-dimethoxyheptanal |
| PubChem CID | 55266110 |
| Molecular Formula | C9H17FO3 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-fluoro-7,7-dimethoxyheptanal |
| SMILES | COC(CCCCC(F)C=O)OC |
| InChI | InChI=1S/C9H17FO3/c1-12-9(13-2)6-4-3-5-8(10)7-11/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZBLCLZALJKJOSF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-7,7-dimethoxyheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-7,7-dimethoxyheptanal?
The IUPAC name of 2-fluoro-7,7-dimethoxyheptanal (CID 55266110) is 2-fluoro-7,7-dimethoxyheptanal.
What is the SMILES notation for 2-fluoro-7,7-dimethoxyheptanal?
The canonical SMILES for 2-fluoro-7,7-dimethoxyheptanal is COC(CCCCC(F)C=O)OC.
What is the InChIKey of 2-fluoro-7,7-dimethoxyheptanal?
The InChIKey is ZBLCLZALJKJOSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FO3/c1-12-9(13-2)6-4-3-5-8(10)7-11/h7-9H,3-6H2,1-2H3.
What are the key properties of 2-fluoro-7,7-dimethoxyheptanal?
2-fluoro-7,7-dimethoxyheptanal has a molecular weight of 192.23 g/mol, XLogP of 1.70, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-7,7-dimethoxyheptanal is sourced from PubChem (CID 55266110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).