About 6-methylimidazo[1,2-a]pyrimidin-2-ol
6-methylimidazo[1,2-a]pyrimidin-2-ol (PubChem CID 55266445) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-methylimidazo[1,2-a]pyrimidin-2-ol.
Molecular Properties
| Compound Name | 6-methylimidazo[1,2-a]pyrimidin-2-ol |
| PubChem CID | 55266445 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-methylimidazo[1,2-a]pyrimidin-2-ol |
| SMILES | Cc1cnc2nc(O)cn2c1 |
| InChI | InChI=1S/C7H7N3O/c1-5-2-8-7-9-6(11)4-10(7)3-5/h2-4,11H,1H3 |
| InChIKey | WLNZKRSZWAEMCF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylimidazo[1,2-a]pyrimidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylimidazo[1,2-a]pyrimidin-2-ol?
The IUPAC name of 6-methylimidazo[1,2-a]pyrimidin-2-ol (CID 55266445) is 6-methylimidazo[1,2-a]pyrimidin-2-ol.
What is the SMILES notation for 6-methylimidazo[1,2-a]pyrimidin-2-ol?
The canonical SMILES for 6-methylimidazo[1,2-a]pyrimidin-2-ol is Cc1cnc2nc(O)cn2c1.
What is the InChIKey of 6-methylimidazo[1,2-a]pyrimidin-2-ol?
The InChIKey is WLNZKRSZWAEMCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-5-2-8-7-9-6(11)4-10(7)3-5/h2-4,11H,1H3.
What are the key properties of 6-methylimidazo[1,2-a]pyrimidin-2-ol?
6-methylimidazo[1,2-a]pyrimidin-2-ol has a molecular weight of 149.15 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylimidazo[1,2-a]pyrimidin-2-ol is sourced from PubChem (CID 55266445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).