C9H15NS — CID 55266682
3-(2,5-dimethylthiophen-3-yl)propan-1-amine (PubChem CID 55266682) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 3-(2,5-dimethylthiophen-3-yl)propan-1-amine.
| Compound Name | 3-(2,5-dimethylthiophen-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 55266682 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-(2,5-dimethylthiophen-3-yl)propan-1-amine |
| SMILES | Cc1cc(CCCN)c(C)s1 |
| InChI | InChI=1S/C9H15NS/c1-7-6-9(4-3-5-10)8(2)11-7/h6H,3-5,10H2,1-2H3 |
| InChIKey | OLUAKLCADQFCLU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |