About 5-fluoroimidazo[1,2-a]pyrimidin-2-ol
5-fluoroimidazo[1,2-a]pyrimidin-2-ol (PubChem CID 55266755) has the molecular formula C6H4FN3O
and a molecular weight of 153.12 g/mol. Its IUPAC name is 5-fluoroimidazo[1,2-a]pyrimidin-2-ol.
Molecular Properties
| Compound Name | 5-fluoroimidazo[1,2-a]pyrimidin-2-ol |
| PubChem CID | 55266755 |
| Molecular Formula | C6H4FN3O |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 5-fluoroimidazo[1,2-a]pyrimidin-2-ol |
| SMILES | Oc1cn2c(F)ccnc2n1 |
| InChI | InChI=1S/C6H4FN3O/c7-4-1-2-8-6-9-5(11)3-10(4)6/h1-3,11H |
| InChIKey | FRMBKJHCCFUFHB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoroimidazo[1,2-a]pyrimidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoroimidazo[1,2-a]pyrimidin-2-ol?
The IUPAC name of 5-fluoroimidazo[1,2-a]pyrimidin-2-ol (CID 55266755) is 5-fluoroimidazo[1,2-a]pyrimidin-2-ol.
What is the SMILES notation for 5-fluoroimidazo[1,2-a]pyrimidin-2-ol?
The canonical SMILES for 5-fluoroimidazo[1,2-a]pyrimidin-2-ol is Oc1cn2c(F)ccnc2n1.
What is the InChIKey of 5-fluoroimidazo[1,2-a]pyrimidin-2-ol?
The InChIKey is FRMBKJHCCFUFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN3O/c7-4-1-2-8-6-9-5(11)3-10(4)6/h1-3,11H.
What are the key properties of 5-fluoroimidazo[1,2-a]pyrimidin-2-ol?
5-fluoroimidazo[1,2-a]pyrimidin-2-ol has a molecular weight of 153.12 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoroimidazo[1,2-a]pyrimidin-2-ol is sourced from PubChem (CID 55266755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).