About 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile
2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile (PubChem CID 55266924) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile.
Molecular Properties
| Compound Name | 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile |
| PubChem CID | 55266924 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1cnc2nc(CN)cn2c1 |
| InChI | InChI=1S/C8H7N5/c9-1-6-3-11-8-12-7(2-10)5-13(8)4-6/h3-5H,2,10H2 |
| InChIKey | ZJRVNEMVSPQKRI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile?
The IUPAC name of 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile (CID 55266924) is 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile.
What is the SMILES notation for 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile?
The canonical SMILES for 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile is N#Cc1cnc2nc(CN)cn2c1.
What is the InChIKey of 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile?
The InChIKey is ZJRVNEMVSPQKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c9-1-6-3-11-8-12-7(2-10)5-13(8)4-6/h3-5H,2,10H2.
What are the key properties of 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile?
2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile has a molecular weight of 173.18 g/mol, XLogP of 0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)imidazo[1,2-a]pyrimidine-6-carbonitrile is sourced from PubChem (CID 55266924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).