About (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane
(2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane (PubChem CID 552672) has the molecular formula C13H26OSi
and a molecular weight of 226.44 g/mol. Its IUPAC name is (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane.
Molecular Properties
| Compound Name | (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane |
| PubChem CID | 552672 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane |
| SMILES | C=CC(C)(CC=C(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-8-13(4,10-9-12(2)3)11-14-15(5,6)7/h8-9H,1,10-11H2,2-7H3 |
| InChIKey | VTSWOTJXCCKPFI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane?
The IUPAC name of (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane (CID 552672) is (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane.
What is the SMILES notation for (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane?
The canonical SMILES for (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane is C=CC(C)(CC=C(C)C)CO[Si](C)(C)C.
What is the InChIKey of (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane?
The InChIKey is VTSWOTJXCCKPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OSi/c1-8-13(4,10-9-12(2)3)11-14-15(5,6)7/h8-9H,1,10-11H2,2-7H3.
What are the key properties of (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane?
(2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane has a molecular weight of 226.44 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethenyl-2,5-dimethylhex-4-enoxy)-trimethylsilane is sourced from PubChem (CID 552672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).