About 2-fluoro-5,5-dimethoxypentanal
2-fluoro-5,5-dimethoxypentanal (PubChem CID 55267389) has the molecular formula C7H13FO3
and a molecular weight of 164.18 g/mol. Its IUPAC name is 2-fluoro-5,5-dimethoxypentanal.
Molecular Properties
| Compound Name | 2-fluoro-5,5-dimethoxypentanal |
| PubChem CID | 55267389 |
| Molecular Formula | C7H13FO3 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-fluoro-5,5-dimethoxypentanal |
| SMILES | COC(CCC(F)C=O)OC |
| InChI | InChI=1S/C7H13FO3/c1-10-7(11-2)4-3-6(8)5-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | IBECIXBWDTZOEH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5,5-dimethoxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5,5-dimethoxypentanal?
The IUPAC name of 2-fluoro-5,5-dimethoxypentanal (CID 55267389) is 2-fluoro-5,5-dimethoxypentanal.
What is the SMILES notation for 2-fluoro-5,5-dimethoxypentanal?
The canonical SMILES for 2-fluoro-5,5-dimethoxypentanal is COC(CCC(F)C=O)OC.
What is the InChIKey of 2-fluoro-5,5-dimethoxypentanal?
The InChIKey is IBECIXBWDTZOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO3/c1-10-7(11-2)4-3-6(8)5-9/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-fluoro-5,5-dimethoxypentanal?
2-fluoro-5,5-dimethoxypentanal has a molecular weight of 164.18 g/mol, XLogP of 0.92, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5,5-dimethoxypentanal is sourced from PubChem (CID 55267389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).