About 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile
3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile (PubChem CID 55267420) has the molecular formula C8H5ClN4
and a molecular weight of 192.61 g/mol. Its IUPAC name is 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile |
| PubChem CID | 55267420 |
| Molecular Formula | C8H5ClN4 |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile |
| SMILES | N#Cc1ccn2c(CCl)nnc2c1 |
| InChI | InChI=1S/C8H5ClN4/c9-4-8-12-11-7-3-6(5-10)1-2-13(7)8/h1-3H,4H2 |
| InChIKey | PUYPRCQRPQETQH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The IUPAC name of 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile (CID 55267420) is 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile.
What is the SMILES notation for 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The canonical SMILES for 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile is N#Cc1ccn2c(CCl)nnc2c1.
What is the InChIKey of 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The InChIKey is PUYPRCQRPQETQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN4/c9-4-8-12-11-7-3-6(5-10)1-2-13(7)8/h1-3H,4H2.
What are the key properties of 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile has a molecular weight of 192.61 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile is sourced from PubChem (CID 55267420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).