C6H3Cl2N3 — CID 55267539
3,6-dichloro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 55267539) has the molecular formula C6H3Cl2N3 and a molecular weight of 188.02 g/mol. Its IUPAC name is 3,6-dichloro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3,6-dichloro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 55267539 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 3,6-dichloro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1ccc2nnc(Cl)n2c1 |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-1-2-5-9-10-6(8)11(5)3-4/h1-3H |
| InChIKey | RTCUWMYFGXWOJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |