About (6S)-1,4-diazabicyclo[4.3.1]decan-2-one
(6S)-1,4-diazabicyclo[4.3.1]decan-2-one (PubChem CID 55268058) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is (6S)-1,4-diazabicyclo[4.3.1]decan-2-one.
Molecular Properties
| Compound Name | (6S)-1,4-diazabicyclo[4.3.1]decan-2-one |
| PubChem CID | 55268058 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (6S)-1,4-diazabicyclo[4.3.1]decan-2-one |
| SMILES | O=C1CNC[C@@H]2CCCN1C2 |
| InChI | InChI=1S/C8H14N2O/c11-8-5-9-4-7-2-1-3-10(8)6-7/h7,9H,1-6H2/t7-/m0/s1 |
| InChIKey | HNPSMBCDYXUULM-ZETCQYMHSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S)-1,4-diazabicyclo[4.3.1]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,4-diazabicyclo[4.3.1]decan-2-one?
The IUPAC name of (6S)-1,4-diazabicyclo[4.3.1]decan-2-one (CID 55268058) is (6S)-1,4-diazabicyclo[4.3.1]decan-2-one.
What is the SMILES notation for (6S)-1,4-diazabicyclo[4.3.1]decan-2-one?
The canonical SMILES for (6S)-1,4-diazabicyclo[4.3.1]decan-2-one is O=C1CNC[C@@H]2CCCN1C2.
What is the InChIKey of (6S)-1,4-diazabicyclo[4.3.1]decan-2-one?
The InChIKey is HNPSMBCDYXUULM-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H14N2O/c11-8-5-9-4-7-2-1-3-10(8)6-7/h7,9H,1-6H2/t7-/m0/s1.
What are the key properties of (6S)-1,4-diazabicyclo[4.3.1]decan-2-one?
(6S)-1,4-diazabicyclo[4.3.1]decan-2-one has a molecular weight of 154.21 g/mol, XLogP of -0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,4-diazabicyclo[4.3.1]decan-2-one is sourced from PubChem (CID 55268058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).