C7H14N4 — CID 55269800
N,N-dimethyl-1-(1H-pyrazol-4-yl)ethane-1,2-diamine (PubChem CID 55269800) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is N,N-dimethyl-1-(1H-pyrazol-4-yl)ethane-1,2-diamine.
| Compound Name | N,N-dimethyl-1-(1H-pyrazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55269800 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | N,N-dimethyl-1-(1H-pyrazol-4-yl)ethane-1,2-diamine |
| SMILES | CN(C)C(CN)c1cn[nH]c1 |
| InChI | InChI=1S/C7H14N4/c1-11(2)7(3-8)6-4-9-10-5-6/h4-5,7H,3,8H2,1-2H3,(H,9,10) |
| InChIKey | FDTVMEHSNIHIFQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |