About (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride
(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride (PubChem CID 55270015) has the molecular formula C9H14ClN3
and a molecular weight of 199.69 g/mol. Its IUPAC name is (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride |
| PubChem CID | 55270015 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride |
| SMILES | Cc1nc(CN)c2c(n1)CCC2.Cl |
| InChI | InChI=1S/C9H13N3.ClH/c1-6-11-8-4-2-3-7(8)9(5-10)12-6;/h2-5,10H2,1H3;1H |
| InChIKey | JOPIYERWCJFJMI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride?
The IUPAC name of (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride (CID 55270015) is (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride?
The canonical SMILES for (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride is Cc1nc(CN)c2c(n1)CCC2.Cl.
What is the InChIKey of (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride?
The InChIKey is JOPIYERWCJFJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3.ClH/c1-6-11-8-4-2-3-7(8)9(5-10)12-6;/h2-5,10H2,1H3;1H.
What are the key properties of (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride?
(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride has a molecular weight of 199.69 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)methanamine;hydrochloride is sourced from PubChem (CID 55270015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).