About (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine
(1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine (PubChem CID 55270342) has the molecular formula C7H8F3N3
and a molecular weight of 191.16 g/mol. Its IUPAC name is (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine |
| PubChem CID | 55270342 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine |
| SMILES | N[C@@H](CC(F)(F)F)c1cnccn1 |
| InChI | InChI=1S/C7H8F3N3/c8-7(9,10)3-5(11)6-4-12-1-2-13-6/h1-2,4-5H,3,11H2/t5-/m0/s1 |
| InChIKey | TTWFUJUERLQREI-YFKPBYRVSA-N |
| XLogP | 1.43 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine?
The IUPAC name of (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine (CID 55270342) is (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine.
What is the SMILES notation for (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine?
The canonical SMILES for (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine is N[C@@H](CC(F)(F)F)c1cnccn1.
What is the InChIKey of (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine?
The InChIKey is TTWFUJUERLQREI-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H8F3N3/c8-7(9,10)3-5(11)6-4-12-1-2-13-6/h1-2,4-5H,3,11H2/t5-/m0/s1.
What are the key properties of (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine?
(1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine has a molecular weight of 191.16 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3,3,3-trifluoro-1-pyrazin-2-ylpropan-1-amine is sourced from PubChem (CID 55270342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).