About (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium
(2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium (PubChem CID 55270442) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium |
| PubChem CID | 55270442 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium |
| SMILES | CCn1cc[n+](C)c1.C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C6H11N2.C3H7NO2/c1-3-8-5-4-7(2)6-8;1-2(4)3(5)6/h4-6H,3H2,1-2H3;2H,4H2,1H3,(H,5,6)/q+1;/p-1/t;2-/m.0/s1 |
| InChIKey | NJYVKYFXBDKITN-WNQIDUERSA-M |
| XLogP | -1.58 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium?
The IUPAC name of (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium (CID 55270442) is (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium.
What is the SMILES notation for (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium?
The canonical SMILES for (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium is CCn1cc[n+](C)c1.C[C@H](N)C(=O)[O-].
What is the InChIKey of (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium?
The InChIKey is NJYVKYFXBDKITN-WNQIDUERSA-M. The full InChI is InChI=1S/C6H11N2.C3H7NO2/c1-3-8-5-4-7(2)6-8;1-2(4)3(5)6/h4-6H,3H2,1-2H3;2H,4H2,1H3,(H,5,6)/q+1;/p-1/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium?
(2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium has a molecular weight of 199.25 g/mol, XLogP of -1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoate;1-ethyl-3-methylimidazol-3-ium is sourced from PubChem (CID 55270442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).