About 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol
1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol (PubChem CID 55270940) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 55270940 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol |
| SMILES | NC1CCc2c1cc(F)c(O)c2F |
| InChI | InChI=1S/C9H9F2NO/c10-6-3-5-4(1-2-7(5)12)8(11)9(6)13/h3,7,13H,1-2,12H2 |
| InChIKey | DZOYGENLRCAPCN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol (CID 55270940) is 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol is NC1CCc2c1cc(F)c(O)c2F.
What is the InChIKey of 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol?
The InChIKey is DZOYGENLRCAPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-6-3-5-4(1-2-7(5)12)8(11)9(6)13/h3,7,13H,1-2,12H2.
What are the key properties of 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol?
1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol has a molecular weight of 185.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 55270940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).