About 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol
3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol (PubChem CID 55271364) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol.
Molecular Properties
| Compound Name | 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol |
| PubChem CID | 55271364 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol |
| SMILES | Cc1c(F)cc(O)c(F)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C10H11F2NO/c1-5-6(11)4-8(14)10(12)9(5)7-2-3-13-7/h4,7,13-14H,2-3H2,1H3/t7-/m0/s1 |
| InChIKey | QKEKEWXGCPYKDT-ZETCQYMHSA-N |
| XLogP | 2.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol?
The IUPAC name of 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol (CID 55271364) is 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol.
What is the SMILES notation for 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol?
The canonical SMILES for 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol is Cc1c(F)cc(O)c(F)c1[C@@H]1CCN1.
What is the InChIKey of 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol?
The InChIKey is QKEKEWXGCPYKDT-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H11F2NO/c1-5-6(11)4-8(14)10(12)9(5)7-2-3-13-7/h4,7,13-14H,2-3H2,1H3/t7-/m0/s1.
What are the key properties of 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol?
3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol has a molecular weight of 199.20 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-azetidin-2-yl]-2,5-difluoro-4-methylphenol is sourced from PubChem (CID 55271364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).