8-methyl-1,6-naphthyridine-3-carboxylic acid

C10H8N2O2 — CID 55271448

IUPAC8-methyl-1,6-naphthyridine-3-carboxylic acid
SMILESCc1cncc2cc(C(=O)O)cnc12
InChIInChI=1S/C10H8N2O2/c1-6-3-11-4-7-2-8(10(13)14)5-12-9(6)7/h2-5H,1H3,(H,13,14)
InChIKeySMGOWXQETBDIPK-UHFFFAOYSA-N
MW188.19 g/mol
LogP1.64
Rot. Bonds1

About 8-methyl-1,6-naphthyridine-3-carboxylic acid

8-methyl-1,6-naphthyridine-3-carboxylic acid (PubChem CID 55271448) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 8-methyl-1,6-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name8-methyl-1,6-naphthyridine-3-carboxylic acid
PubChem CID55271448
Molecular FormulaC10H8N2O2
Molecular Weight188.19 g/mol
Exact Mass188.06
IUPAC Name8-methyl-1,6-naphthyridine-3-carboxylic acid
SMILESCc1cncc2cc(C(=O)O)cnc12
InChIInChI=1S/C10H8N2O2/c1-6-3-11-4-7-2-8(10(13)14)5-12-9(6)7/h2-5H,1H3,(H,13,14)
InChIKeySMGOWXQETBDIPK-UHFFFAOYSA-N
XLogP1.64
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.19
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 8-methyl-1,6-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

quinoline-3,5,6,7,8-pentacarboxylic acid
CID 22158723
8-(dimethylamino)quinoline-3-carboxylic acid
CID 105469716
7-amino-6-methylquinoline-3-carboxylic acid
CID 129276404
2-(5-methyl-3-pyridinyl)pyrimidine-5-carboxylic acid
CID 177164317
6,8-difluoroquinoline-3-carboxylic acid
CID 22452302
pyridine-3,5-dicarboxylic acid;hydrochloride
CID 66910809
pyridine-3,5-dicarboxylic acid;dihydrobromide
CID 139466512
6,7-dihydroxyquinoline-3-carboxylic acid
CID 135795174
8-methylsulfanylquinoline-3-carboxylic acid
CID 126609848
dimethyl 8-methylquinoline-3,6-dicarboxylate
CID 164676656
5-methyl-6-pyrrolidin-1-ylpyridine-3-carboxylic acid
CID 66935695
8-bromoquinoline-3-carboxylic acid;hydrate
CID 71710960

Frequently Asked Questions

What is the IUPAC name of 8-methyl-1,6-naphthyridine-3-carboxylic acid?
The IUPAC name of 8-methyl-1,6-naphthyridine-3-carboxylic acid (CID 55271448) is 8-methyl-1,6-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 8-methyl-1,6-naphthyridine-3-carboxylic acid?
The canonical SMILES for 8-methyl-1,6-naphthyridine-3-carboxylic acid is Cc1cncc2cc(C(=O)O)cnc12.
What is the InChIKey of 8-methyl-1,6-naphthyridine-3-carboxylic acid?
The InChIKey is SMGOWXQETBDIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-6-3-11-4-7-2-8(10(13)14)5-12-9(6)7/h2-5H,1H3,(H,13,14).
What are the key properties of 8-methyl-1,6-naphthyridine-3-carboxylic acid?
8-methyl-1,6-naphthyridine-3-carboxylic acid has a molecular weight of 188.19 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,6-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 55271448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).