About 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile
3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile (PubChem CID 55273343) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile |
| PubChem CID | 55273343 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile |
| SMILES | N#CCC(N)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H10N4/c11-3-1-9(12)8-5-7-2-4-13-10(7)14-6-8/h2,4-6,9H,1,12H2,(H,13,14) |
| InChIKey | BOJLYCFLAXIPGA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile?
The IUPAC name of 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile (CID 55273343) is 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile.
What is the SMILES notation for 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile?
The canonical SMILES for 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile is N#CCC(N)c1cnc2[nH]ccc2c1.
What is the InChIKey of 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile?
The InChIKey is BOJLYCFLAXIPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-3-1-9(12)8-5-7-2-4-13-10(7)14-6-8/h2,4-6,9H,1,12H2,(H,13,14).
What are the key properties of 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile?
3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile has a molecular weight of 186.22 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)propanenitrile is sourced from PubChem (CID 55273343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).