About [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride
[(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride (PubChem CID 55273587) has the molecular formula C7H12ClNO2
and a molecular weight of 177.63 g/mol. Its IUPAC name is [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride |
| PubChem CID | 55273587 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride |
| SMILES | Cl.NC1C(CO)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C7H11NO2.ClH/c8-7-4(3-9)5-1-2-6(7)10-5;/h1-2,4-7,9H,3,8H2;1H/t4?,5-,6+,7?;/m1./s1 |
| InChIKey | BXZHQCAWQFZXMB-TUDXJLBUSA-N |
| XLogP | -0.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride?
The IUPAC name of [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride (CID 55273587) is [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride?
The canonical SMILES for [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride is Cl.NC1C(CO)[C@H]2C=C[C@@H]1O2.
What is the InChIKey of [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride?
The InChIKey is BXZHQCAWQFZXMB-TUDXJLBUSA-N. The full InChI is InChI=1S/C7H11NO2.ClH/c8-7-4(3-9)5-1-2-6(7)10-5;/h1-2,4-7,9H,3,8H2;1H/t4?,5-,6+,7?;/m1./s1.
What are the key properties of [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride?
[(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride has a molecular weight of 177.63 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S)-3-amino-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol;hydrochloride is sourced from PubChem (CID 55273587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).