About (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine
(1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine (PubChem CID 55274092) has the molecular formula C7H8F3NS
and a molecular weight of 195.21 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine.
Molecular Properties
| Compound Name | (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine |
| PubChem CID | 55274092 |
| Molecular Formula | C7H8F3NS |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine |
| SMILES | Cc1cc([C@@H](N)C(F)(F)F)cs1 |
| InChI | InChI=1S/C7H8F3NS/c1-4-2-5(3-12-4)6(11)7(8,9)10/h2-3,6H,11H2,1H3/t6-/m1/s1 |
| InChIKey | QLWHXCVLEAEQES-ZCFIWIBFSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine?
The IUPAC name of (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine (CID 55274092) is (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine.
What is the SMILES notation for (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine?
The canonical SMILES for (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine is Cc1cc([C@@H](N)C(F)(F)F)cs1.
What is the InChIKey of (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine?
The InChIKey is QLWHXCVLEAEQES-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H8F3NS/c1-4-2-5(3-12-4)6(11)7(8,9)10/h2-3,6H,11H2,1H3/t6-/m1/s1.
What are the key properties of (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine?
(1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine has a molecular weight of 195.21 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trifluoro-1-(5-methylthiophen-3-yl)ethanamine is sourced from PubChem (CID 55274092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).