About 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine
5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine (PubChem CID 55274382) has the molecular formula C7H8F3N3
and a molecular weight of 191.16 g/mol. Its IUPAC name is 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine |
| PubChem CID | 55274382 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine |
| SMILES | Nc1cncc([C@@H](N)C(F)(F)F)c1 |
| InChI | InChI=1S/C7H8F3N3/c8-7(9,10)6(12)4-1-5(11)3-13-2-4/h1-3,6H,11-12H2/t6-/m1/s1 |
| InChIKey | PNCBRWHZHSQTLN-ZCFIWIBFSA-N |
| XLogP | 1.23 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine?
The IUPAC name of 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine (CID 55274382) is 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine.
What is the SMILES notation for 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine?
The canonical SMILES for 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine is Nc1cncc([C@@H](N)C(F)(F)F)c1.
What is the InChIKey of 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine?
The InChIKey is PNCBRWHZHSQTLN-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H8F3N3/c8-7(9,10)6(12)4-1-5(11)3-13-2-4/h1-3,6H,11-12H2/t6-/m1/s1.
What are the key properties of 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine?
5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine has a molecular weight of 191.16 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine is sourced from PubChem (CID 55274382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).