About 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one
4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one (PubChem CID 55274579) has the molecular formula C9H6F2O2
and a molecular weight of 184.14 g/mol. Its IUPAC name is 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 55274579 |
| Molecular Formula | C9H6F2O2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c(F)cc(O)c(F)c21 |
| InChI | InChI=1S/C9H6F2O2/c10-5-3-7(13)9(11)8-4(5)1-2-6(8)12/h3,13H,1-2H2 |
| InChIKey | SYIFOQQYVSHKFB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one (CID 55274579) is 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one is O=C1CCc2c(F)cc(O)c(F)c21.
What is the InChIKey of 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is SYIFOQQYVSHKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2O2/c10-5-3-7(13)9(11)8-4(5)1-2-6(8)12/h3,13H,1-2H2.
What are the key properties of 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one?
4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 184.14 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-difluoro-6-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 55274579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).