About 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate
1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate (PubChem CID 552746) has the molecular formula C27H56O4Si2
and a molecular weight of 500.91 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate.
Molecular Properties
| Compound Name | 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate |
| PubChem CID | 552746 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h15-16,26H,8-14,17-25H2,1-7H3 |
| InChIKey | LPQFHKYPXYZZOR-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The IUPAC name of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate (CID 552746) is 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate.
What is the SMILES notation for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The canonical SMILES for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C.
What is the InChIKey of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The InChIKey is LPQFHKYPXYZZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H56O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h15-16,26H,8-14,17-25H2,1-7H3.
What are the key properties of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate has a molecular weight of 500.91 g/mol, XLogP of 8.64, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate is sourced from PubChem (CID 552746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).