1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate

C27H56O4Si2 — CID 552746

IUPAC1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate
SMILESCCCCCCCCC=CCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C
InChIInChI=1S/C27H56O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h15-16,26H,8-14,17-25H2,1-7H3
InChIKeyLPQFHKYPXYZZOR-UHFFFAOYSA-N
MW500.91 g/mol
LogP8.64
Rot. Bonds22

About 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate

1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate (PubChem CID 552746) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate.

Molecular Properties

Compound Name1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate
PubChem CID552746
Molecular FormulaC27H56O4Si2
Molecular Weight500.91 g/mol
Exact Mass500.37
IUPAC Name1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate
SMILESCCCCCCCCC=CCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C
InChIInChI=1S/C27H56O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h15-16,26H,8-14,17-25H2,1-7H3
InChIKeyLPQFHKYPXYZZOR-UHFFFAOYSA-N
XLogP8.64
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds22
Heavy Atoms33
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500500.91
LogP ≤ 58.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The IUPAC name of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate (CID 552746) is 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate.
What is the SMILES notation for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The canonical SMILES for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C.
What is the InChIKey of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
The InChIKey is LPQFHKYPXYZZOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H56O4Si2/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(28)31-26(24-29-32(2,3)4)25-30-33(5,6)7/h15-16,26H,8-14,17-25H2,1-7H3.
What are the key properties of 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate?
1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate has a molecular weight of 500.91 g/mol, XLogP of 8.64, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(trimethylsilyloxy)propan-2-yl octadec-9-enoate is sourced from PubChem (CID 552746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).