About 1-(1,2-thiazol-5-yl)ethane-1,2-diamine
1-(1,2-thiazol-5-yl)ethane-1,2-diamine (PubChem CID 55274616) has the molecular formula C5H9N3S
and a molecular weight of 143.22 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1,2-thiazol-5-yl)ethane-1,2-diamine |
| PubChem CID | 55274616 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)ethane-1,2-diamine |
| SMILES | NCC(N)c1ccns1 |
| InChI | InChI=1S/C5H9N3S/c6-3-4(7)5-1-2-8-9-5/h1-2,4H,3,6-7H2 |
| InChIKey | SKCDQNXUNHXINO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2-thiazol-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-thiazol-5-yl)ethane-1,2-diamine?
The IUPAC name of 1-(1,2-thiazol-5-yl)ethane-1,2-diamine (CID 55274616) is 1-(1,2-thiazol-5-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(1,2-thiazol-5-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(1,2-thiazol-5-yl)ethane-1,2-diamine is NCC(N)c1ccns1.
What is the InChIKey of 1-(1,2-thiazol-5-yl)ethane-1,2-diamine?
The InChIKey is SKCDQNXUNHXINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c6-3-4(7)5-1-2-8-9-5/h1-2,4H,3,6-7H2.
What are the key properties of 1-(1,2-thiazol-5-yl)ethane-1,2-diamine?
1-(1,2-thiazol-5-yl)ethane-1,2-diamine has a molecular weight of 143.22 g/mol, XLogP of 0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-thiazol-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 55274616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).