About (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol
(1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol (PubChem CID 55274996) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 55274996 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol |
| SMILES | N[C@@H]1CCc2c(O)c(F)cc(F)c21 |
| InChI | InChI=1S/C9H9F2NO/c10-5-3-6(11)9(13)4-1-2-7(12)8(4)5/h3,7,13H,1-2,12H2/t7-/m1/s1 |
| InChIKey | RRJCCMHBDRDIFE-SSDOTTSWSA-N |
| XLogP | 1.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol (CID 55274996) is (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol is N[C@@H]1CCc2c(O)c(F)cc(F)c21.
What is the InChIKey of (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol?
The InChIKey is RRJCCMHBDRDIFE-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-5-3-6(11)9(13)4-1-2-7(12)8(4)5/h3,7,13H,1-2,12H2/t7-/m1/s1.
What are the key properties of (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol?
(1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol has a molecular weight of 185.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-amino-5,7-difluoro-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 55274996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).