C11H13N3 — CID 55275195
1-quinolin-5-ylethane-1,2-diamine (PubChem CID 55275195) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-quinolin-5-ylethane-1,2-diamine.
| Compound Name | 1-quinolin-5-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 55275195 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-quinolin-5-ylethane-1,2-diamine |
| SMILES | NCC(N)c1cccc2ncccc12 |
| InChI | InChI=1S/C11H13N3/c12-7-10(13)8-3-1-5-11-9(8)4-2-6-14-11/h1-6,10H,7,12-13H2 |
| InChIKey | YNYFFGGOSFJCBG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |