About (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine
(1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine (PubChem CID 55275275) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine.
Molecular Properties
| Compound Name | (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine |
| PubChem CID | 55275275 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine |
| SMILES | Nc1cc(F)c2c(c1)[C@H](N)CC2 |
| InChI | InChI=1S/C9H11FN2/c10-8-4-5(11)3-7-6(8)1-2-9(7)12/h3-4,9H,1-2,11-12H2/t9-/m1/s1 |
| InChIKey | QVYGIDSSOZGDND-SECBINFHSA-N |
| XLogP | 1.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine?
The IUPAC name of (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine (CID 55275275) is (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine.
What is the SMILES notation for (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine?
The canonical SMILES for (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine is Nc1cc(F)c2c(c1)[C@H](N)CC2.
What is the InChIKey of (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine?
The InChIKey is QVYGIDSSOZGDND-SECBINFHSA-N. The full InChI is InChI=1S/C9H11FN2/c10-8-4-5(11)3-7-6(8)1-2-9(7)12/h3-4,9H,1-2,11-12H2/t9-/m1/s1.
What are the key properties of (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine?
(1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine has a molecular weight of 166.20 g/mol, XLogP of 1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4-fluoro-2,3-dihydro-1H-indene-1,6-diamine is sourced from PubChem (CID 55275275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).