About 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole
4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole (PubChem CID 55275495) has the molecular formula C11H12ClN
and a molecular weight of 193.68 g/mol. Its IUPAC name is 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole |
| PubChem CID | 55275495 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole |
| SMILES | C=C(C)N1Cc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C11H12ClN/c1-8(2)13-6-9-4-3-5-11(12)10(9)7-13/h3-5H,1,6-7H2,2H3 |
| InChIKey | BBUKVLUJRYHCGJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole?
The IUPAC name of 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole (CID 55275495) is 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole.
What is the SMILES notation for 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole?
The canonical SMILES for 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole is C=C(C)N1Cc2cccc(Cl)c2C1.
What is the InChIKey of 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole?
The InChIKey is BBUKVLUJRYHCGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN/c1-8(2)13-6-9-4-3-5-11(12)10(9)7-13/h3-5H,1,6-7H2,2H3.
What are the key properties of 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole?
4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole has a molecular weight of 193.68 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-prop-1-en-2-yl-1,3-dihydroisoindole is sourced from PubChem (CID 55275495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).