About (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine
(1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine (PubChem CID 55275978) has the molecular formula C7H6F4N2
and a molecular weight of 194.13 g/mol. Its IUPAC name is (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine.
Molecular Properties
| Compound Name | (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine |
| PubChem CID | 55275978 |
| Molecular Formula | C7H6F4N2 |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine |
| SMILES | C[C@@H](N)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H6F4N2/c1-2(12)3-4(8)6(10)13-7(11)5(3)9/h2H,12H2,1H3/t2-/m1/s1 |
| InChIKey | LEXBKVLIOAVBQQ-UWTATZPHSA-N |
| XLogP | 1.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The IUPAC name of (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine (CID 55275978) is (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine.
What is the SMILES notation for (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The canonical SMILES for (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine is C[C@@H](N)c1c(F)c(F)nc(F)c1F.
What is the InChIKey of (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
The InChIKey is LEXBKVLIOAVBQQ-UWTATZPHSA-N. The full InChI is InChI=1S/C7H6F4N2/c1-2(12)3-4(8)6(10)13-7(11)5(3)9/h2H,12H2,1H3/t2-/m1/s1.
What are the key properties of (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine?
(1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine has a molecular weight of 194.13 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,3,5,6-tetrafluoro-4-pyridinyl)ethanamine is sourced from PubChem (CID 55275978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).