About 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one
6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (PubChem CID 55276476) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| PubChem CID | 55276476 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| SMILES | O=C1NCCn2cncc21 |
| InChI | InChI=1S/C6H7N3O/c10-6-5-3-7-4-9(5)2-1-8-6/h3-4H,1-2H2,(H,8,10) |
| InChIKey | WXWQYMIMMRLBAN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The IUPAC name of 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (CID 55276476) is 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one.
What is the SMILES notation for 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The canonical SMILES for 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one is O=C1NCCn2cncc21.
What is the InChIKey of 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The InChIKey is WXWQYMIMMRLBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c10-6-5-3-7-4-9(5)2-1-8-6/h3-4H,1-2H2,(H,8,10).
What are the key properties of 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one has a molecular weight of 137.14 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one is sourced from PubChem (CID 55276476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).