C9H12N2O3 — CID 55276625
5-[(2S)-2-amino-1-hydroxypropan-2-yl]pyridine-3-carboxylic acid (PubChem CID 55276625) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-[(2S)-2-amino-1-hydroxypropan-2-yl]pyridine-3-carboxylic acid.
| Compound Name | 5-[(2S)-2-amino-1-hydroxypropan-2-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 55276625 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5-[(2S)-2-amino-1-hydroxypropan-2-yl]pyridine-3-carboxylic acid |
| SMILES | C[C@@](N)(CO)c1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C9H12N2O3/c1-9(10,5-12)7-2-6(8(13)14)3-11-4-7/h2-4,12H,5,10H2,1H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | BTDCILLGPXQNJI-SECBINFHSA-N |
| XLogP | -0.05 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |