About (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol
(2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol (PubChem CID 55278047) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol.
Molecular Properties
| Compound Name | (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol |
| PubChem CID | 55278047 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol |
| SMILES | N[C@H](CO)c1cccc2c1NCC2 |
| InChI | InChI=1S/C10H14N2O/c11-9(6-13)8-3-1-2-7-4-5-12-10(7)8/h1-3,9,12-13H,4-6,11H2/t9-/m1/s1 |
| InChIKey | SXWPEAYGLBNJDI-SECBINFHSA-N |
| XLogP | 0.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol?
The IUPAC name of (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol (CID 55278047) is (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol.
What is the SMILES notation for (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol?
The canonical SMILES for (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol is N[C@H](CO)c1cccc2c1NCC2.
What is the InChIKey of (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol?
The InChIKey is SXWPEAYGLBNJDI-SECBINFHSA-N. The full InChI is InChI=1S/C10H14N2O/c11-9(6-13)8-3-1-2-7-4-5-12-10(7)8/h1-3,9,12-13H,4-6,11H2/t9-/m1/s1.
What are the key properties of (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol?
(2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol has a molecular weight of 178.23 g/mol, XLogP of 0.65, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(2,3-dihydro-1H-indol-7-yl)ethanol is sourced from PubChem (CID 55278047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).