C10H15NO3 — CID 55278202
(2S)-2-amino-2-(2,3-dimethoxyphenyl)ethanol (PubChem CID 55278202) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3-dimethoxyphenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(2,3-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 55278202 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2S)-2-amino-2-(2,3-dimethoxyphenyl)ethanol |
| SMILES | COc1cccc([C@H](N)CO)c1OC |
| InChI | InChI=1S/C10H15NO3/c1-13-9-5-3-4-7(8(11)6-12)10(9)14-2/h3-5,8,12H,6,11H2,1-2H3/t8-/m1/s1 |
| InChIKey | GMSUFURUEUIACW-MRVPVSSYSA-N |
| XLogP | 0.70 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |