About (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane
(1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane (PubChem CID 55279054) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane |
| PubChem CID | 55279054 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane |
| SMILES | FC1(F)[C@@H]2CNC[C@H]1COC2 |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)5-1-10-2-6(7)4-11-3-5/h5-6,10H,1-4H2/t5-,6+ |
| InChIKey | ZGGHCXRVEDILOZ-OLQVQODUSA-N |
| XLogP | 0.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane?
The IUPAC name of (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane (CID 55279054) is (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane.
What is the SMILES notation for (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane?
The canonical SMILES for (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane is FC1(F)[C@@H]2CNC[C@H]1COC2.
What is the InChIKey of (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane?
The InChIKey is ZGGHCXRVEDILOZ-OLQVQODUSA-N. The full InChI is InChI=1S/C7H11F2NO/c8-7(9)5-1-10-2-6(7)4-11-3-5/h5-6,10H,1-4H2/t5-,6+.
What are the key properties of (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane?
(1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane has a molecular weight of 163.17 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-9,9-difluoro-3-oxa-7-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 55279054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).