About 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one
2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 55279068) has the molecular formula C7H7N3OS
and a molecular weight of 181.22 g/mol. Its IUPAC name is 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 55279068 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CSc1ncc2c(n1)NC(=O)C2 |
| InChI | InChI=1S/C7H7N3OS/c1-12-7-8-3-4-2-5(11)9-6(4)10-7/h3H,2H2,1H3,(H,8,9,10,11) |
| InChIKey | ZQSFYLNLENLZHO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (CID 55279068) is 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is CSc1ncc2c(n1)NC(=O)C2.
What is the InChIKey of 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is ZQSFYLNLENLZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS/c1-12-7-8-3-4-2-5(11)9-6(4)10-7/h3H,2H2,1H3,(H,8,9,10,11).
What are the key properties of 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 181.22 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 55279068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).