About 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide
2λ4-thia-6-azaspiro[3.3]heptane 2-oxide (PubChem CID 55279072) has the molecular formula C5H9NOS
and a molecular weight of 131.20 g/mol. Its IUPAC name is 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide.
Molecular Properties
| Compound Name | 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide |
| PubChem CID | 55279072 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide |
| SMILES | O=S1CC2(CNC2)C1 |
| InChI | InChI=1S/C5H9NOS/c7-8-3-5(4-8)1-6-2-5/h6H,1-4H2 |
| InChIKey | YSYFHRIMYHBTIO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide?
The IUPAC name of 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide (CID 55279072) is 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide.
What is the SMILES notation for 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide?
The canonical SMILES for 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide is O=S1CC2(CNC2)C1.
What is the InChIKey of 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide?
The InChIKey is YSYFHRIMYHBTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NOS/c7-8-3-5(4-8)1-6-2-5/h6H,1-4H2.
What are the key properties of 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide?
2λ4-thia-6-azaspiro[3.3]heptane 2-oxide has a molecular weight of 131.20 g/mol, XLogP of -0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2λ4-thia-6-azaspiro[3.3]heptane 2-oxide is sourced from PubChem (CID 55279072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).