About (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine
(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 55279150) has the molecular formula C6H8N6S
and a molecular weight of 196.24 g/mol. Its IUPAC name is (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| PubChem CID | 55279150 |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | NNc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C6H8N6S/c7-11-4-3-1-2-13-5(3)10-6(9-4)12-8/h1-2H,7-8H2,(H2,9,10,11,12) |
| InChIKey | LMJSJJBXNLVCKN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The IUPAC name of (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CID 55279150) is (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine.
What is the SMILES notation for (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The canonical SMILES for (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine is NNc1nc(NN)c2ccsc2n1.
What is the InChIKey of (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
The InChIKey is LMJSJJBXNLVCKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6S/c7-11-4-3-1-2-13-5(3)10-6(9-4)12-8/h1-2H,7-8H2,(H2,9,10,11,12).
What are the key properties of (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine?
(2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine has a molecular weight of 196.24 g/mol, XLogP of 0.26, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)hydrazine is sourced from PubChem (CID 55279150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).