About trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine
trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine (PubChem CID 55279157) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine |
| PubChem CID | 55279157 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine |
| SMILES | NN[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C6H15N3/c7-5-3-1-2-4-6(5)9-8/h5-6,9H,1-4,7-8H2/t5-,6-/m1/s1 |
| InChIKey | UOZKMKSDMRHKCP-PHDIDXHHSA-N |
| XLogP | -0.28 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine?
The IUPAC name of trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine (CID 55279157) is trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine.
What is the SMILES notation for trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine?
The canonical SMILES for trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine is NN[C@@H]1CCCC[C@H]1N.
What is the InChIKey of trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine?
The InChIKey is UOZKMKSDMRHKCP-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H15N3/c7-5-3-1-2-4-6(5)9-8/h5-6,9H,1-4,7-8H2/t5-,6-/m1/s1.
What are the key properties of trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine?
trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine has a molecular weight of 129.21 g/mol, XLogP of -0.28, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-hydrazinylcyclohexan-1-amine is sourced from PubChem (CID 55279157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).