About 3-amino-1,1-di(propan-2-yl)thiourea
3-amino-1,1-di(propan-2-yl)thiourea (PubChem CID 55279270) has the molecular formula C7H17N3S
and a molecular weight of 175.30 g/mol. Its IUPAC name is 3-amino-1,1-di(propan-2-yl)thiourea.
Molecular Properties
| Compound Name | 3-amino-1,1-di(propan-2-yl)thiourea |
| PubChem CID | 55279270 |
| Molecular Formula | C7H17N3S |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-amino-1,1-di(propan-2-yl)thiourea |
| SMILES | CC(C)N(C(=S)NN)C(C)C |
| InChI | InChI=1S/C7H17N3S/c1-5(2)10(6(3)4)7(11)9-8/h5-6H,8H2,1-4H3,(H,9,11) |
| InChIKey | WGLIMENOMXJJGZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,1-di(propan-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1-di(propan-2-yl)thiourea?
The IUPAC name of 3-amino-1,1-di(propan-2-yl)thiourea (CID 55279270) is 3-amino-1,1-di(propan-2-yl)thiourea.
What is the SMILES notation for 3-amino-1,1-di(propan-2-yl)thiourea?
The canonical SMILES for 3-amino-1,1-di(propan-2-yl)thiourea is CC(C)N(C(=S)NN)C(C)C.
What is the InChIKey of 3-amino-1,1-di(propan-2-yl)thiourea?
The InChIKey is WGLIMENOMXJJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3S/c1-5(2)10(6(3)4)7(11)9-8/h5-6H,8H2,1-4H3,(H,9,11).
What are the key properties of 3-amino-1,1-di(propan-2-yl)thiourea?
3-amino-1,1-di(propan-2-yl)thiourea has a molecular weight of 175.30 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1-di(propan-2-yl)thiourea is sourced from PubChem (CID 55279270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).