About N'-amino-1,3-thiazole-2-carboximidamide
N'-amino-1,3-thiazole-2-carboximidamide (PubChem CID 55279378) has the molecular formula C4H6N4S
and a molecular weight of 142.19 g/mol. Its IUPAC name is N'-amino-1,3-thiazole-2-carboximidamide.
Molecular Properties
| Compound Name | N'-amino-1,3-thiazole-2-carboximidamide |
| PubChem CID | 55279378 |
| Molecular Formula | C4H6N4S |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | N'-amino-1,3-thiazole-2-carboximidamide |
| SMILES | N/N=C(\N)c1nccs1 |
| InChI | InChI=1S/C4H6N4S/c5-3(8-6)4-7-1-2-9-4/h1-2H,6H2,(H2,5,8) |
| InChIKey | MBNLZUCXIWNGOC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-1,3-thiazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-1,3-thiazole-2-carboximidamide?
The IUPAC name of N'-amino-1,3-thiazole-2-carboximidamide (CID 55279378) is N'-amino-1,3-thiazole-2-carboximidamide.
What is the SMILES notation for N'-amino-1,3-thiazole-2-carboximidamide?
The canonical SMILES for N'-amino-1,3-thiazole-2-carboximidamide is N/N=C(\N)c1nccs1.
What is the InChIKey of N'-amino-1,3-thiazole-2-carboximidamide?
The InChIKey is MBNLZUCXIWNGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4S/c5-3(8-6)4-7-1-2-9-4/h1-2H,6H2,(H2,5,8).
What are the key properties of N'-amino-1,3-thiazole-2-carboximidamide?
N'-amino-1,3-thiazole-2-carboximidamide has a molecular weight of 142.19 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-1,3-thiazole-2-carboximidamide is sourced from PubChem (CID 55279378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).